C12H25O6P — CID 123477427
propan-2-yl 2-[2-ethylbutoxy(hydroxy)phosphoryl]oxypropanoate (PubChem CID 123477427) has the molecular formula C12H25O6P and a molecular weight of 296.30 g/mol. Its IUPAC name is propan-2-yl 2-[2-ethylbutoxy(hydroxy)phosphoryl]oxypropanoate.
| Compound Name | propan-2-yl 2-[2-ethylbutoxy(hydroxy)phosphoryl]oxypropanoate |
|---|---|
| PubChem CID | 123477427 |
| Molecular Formula | C12H25O6P |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | propan-2-yl 2-[2-ethylbutoxy(hydroxy)phosphoryl]oxypropanoate |
| SMILES | CCC(CC)COP(=O)(O)OC(C)C(=O)OC(C)C |
| InChI | InChI=1S/C12H25O6P/c1-6-11(7-2)8-16-19(14,15)18-10(5)12(13)17-9(3)4/h9-11H,6-8H2,1-5H3,(H,14,15) |
| InChIKey | ZDYSFLXZIHLDCJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|