About 2-hexyloctyl octan-2-yl hydrogen phosphate
2-hexyloctyl octan-2-yl hydrogen phosphate (PubChem CID 139608562) has the molecular formula C22H47O4P
and a molecular weight of 406.59 g/mol. Its IUPAC name is 2-hexyloctyl octan-2-yl hydrogen phosphate.
Molecular Properties
| Compound Name | 2-hexyloctyl octan-2-yl hydrogen phosphate |
| PubChem CID | 139608562 |
| Molecular Formula | C22H47O4P |
| Molecular Weight | 406.59 g/mol |
| Exact Mass | 406.32 |
| IUPAC Name | 2-hexyloctyl octan-2-yl hydrogen phosphate |
| SMILES | CCCCCCC(CCCCCC)COP(=O)(O)OC(C)CCCCCC |
| InChI | InChI=1S/C22H47O4P/c1-5-8-11-14-17-21(4)26-27(23,24)25-20-22(18-15-12-9-6-2)19-16-13-10-7-3/h21-22H,5-20H2,1-4H3,(H,23,24) |
| InChIKey | TWOCAGHPFOYNFY-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.59 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-hexyloctyl octan-2-yl hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexyloctyl octan-2-yl hydrogen phosphate?
The IUPAC name of 2-hexyloctyl octan-2-yl hydrogen phosphate (CID 139608562) is 2-hexyloctyl octan-2-yl hydrogen phosphate.
What is the SMILES notation for 2-hexyloctyl octan-2-yl hydrogen phosphate?
The canonical SMILES for 2-hexyloctyl octan-2-yl hydrogen phosphate is CCCCCCC(CCCCCC)COP(=O)(O)OC(C)CCCCCC.
What is the InChIKey of 2-hexyloctyl octan-2-yl hydrogen phosphate?
The InChIKey is TWOCAGHPFOYNFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H47O4P/c1-5-8-11-14-17-21(4)26-27(23,24)25-20-22(18-15-12-9-6-2)19-16-13-10-7-3/h21-22H,5-20H2,1-4H3,(H,23,24).
What are the key properties of 2-hexyloctyl octan-2-yl hydrogen phosphate?
2-hexyloctyl octan-2-yl hydrogen phosphate has a molecular weight of 406.59 g/mol, XLogP of 8.04, 20 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexyloctyl octan-2-yl hydrogen phosphate is sourced from PubChem (CID 139608562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).