About dipotassium;2-hexyldecyl phosphate
dipotassium;2-hexyldecyl phosphate (PubChem CID 56842986) has the molecular formula C16H33K2O4P
and a molecular weight of 398.61 g/mol. Its IUPAC name is dipotassium;2-hexyldecyl phosphate.
Molecular Properties
| Compound Name | dipotassium;2-hexyldecyl phosphate |
| PubChem CID | 56842986 |
| Molecular Formula | C16H33K2O4P |
| Molecular Weight | 398.61 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | dipotassium;2-hexyldecyl phosphate |
| SMILES | CCCCCCCCC(CCCCCC)COP(=O)([O-])[O-].[K+].[K+] |
| InChI | InChI=1S/C16H35O4P.2K/c1-3-5-7-9-10-12-14-16(13-11-8-6-4-2)15-20-21(17,18)19;;/h16H,3-15H2,1-2H3,(H2,17,18,19);;/q;2*+1/p-2 |
| InChIKey | SQPKAMSHYOALMB-UHFFFAOYSA-L |
| XLogP | -1.82 |
| TPSA | 72.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.61 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;2-hexyldecyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;2-hexyldecyl phosphate?
The IUPAC name of dipotassium;2-hexyldecyl phosphate (CID 56842986) is dipotassium;2-hexyldecyl phosphate.
What is the SMILES notation for dipotassium;2-hexyldecyl phosphate?
The canonical SMILES for dipotassium;2-hexyldecyl phosphate is CCCCCCCCC(CCCCCC)COP(=O)([O-])[O-].[K+].[K+].
What is the InChIKey of dipotassium;2-hexyldecyl phosphate?
The InChIKey is SQPKAMSHYOALMB-UHFFFAOYSA-L. The full InChI is InChI=1S/C16H35O4P.2K/c1-3-5-7-9-10-12-14-16(13-11-8-6-4-2)15-20-21(17,18)19;;/h16H,3-15H2,1-2H3,(H2,17,18,19);;/q;2*+1/p-2.
What are the key properties of dipotassium;2-hexyldecyl phosphate?
dipotassium;2-hexyldecyl phosphate has a molecular weight of 398.61 g/mol, XLogP of -1.82, 15 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;2-hexyldecyl phosphate is sourced from PubChem (CID 56842986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).