About tripotassium;2-hexyldecan-1-ol;phosphate
tripotassium;2-hexyldecan-1-ol;phosphate (PubChem CID 175022453) has the molecular formula C16H34K3O5P
and a molecular weight of 454.71 g/mol. Its IUPAC name is tripotassium;2-hexyldecan-1-ol;phosphate.
Molecular Properties
| Compound Name | tripotassium;2-hexyldecan-1-ol;phosphate |
| PubChem CID | 175022453 |
| Molecular Formula | C16H34K3O5P |
| Molecular Weight | 454.71 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | tripotassium;2-hexyldecan-1-ol;phosphate |
| SMILES | CCCCCCCCC(CO)CCCCCC.O=P([O-])([O-])[O-].[K+].[K+].[K+] |
| InChI | InChI=1S/C16H34O.3K.H3O4P/c1-3-5-7-9-10-12-14-16(15-17)13-11-8-6-4-2;;;;1-5(2,3)4/h16-17H,3-15H2,1-2H3;;;;(H3,1,2,3,4)/q;3*+1;/p-3 |
| InChIKey | IKFCXKMPUYUJNR-UHFFFAOYSA-K |
| XLogP | -6.50 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.71 |
| LogP ≤ 5 | -6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tripotassium;2-hexyldecan-1-ol;phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tripotassium;2-hexyldecan-1-ol;phosphate?
The IUPAC name of tripotassium;2-hexyldecan-1-ol;phosphate (CID 175022453) is tripotassium;2-hexyldecan-1-ol;phosphate.
What is the SMILES notation for tripotassium;2-hexyldecan-1-ol;phosphate?
The canonical SMILES for tripotassium;2-hexyldecan-1-ol;phosphate is CCCCCCCCC(CO)CCCCCC.O=P([O-])([O-])[O-].[K+].[K+].[K+].
What is the InChIKey of tripotassium;2-hexyldecan-1-ol;phosphate?
The InChIKey is IKFCXKMPUYUJNR-UHFFFAOYSA-K. The full InChI is InChI=1S/C16H34O.3K.H3O4P/c1-3-5-7-9-10-12-14-16(15-17)13-11-8-6-4-2;;;;1-5(2,3)4/h16-17H,3-15H2,1-2H3;;;;(H3,1,2,3,4)/q;3*+1;/p-3.
What are the key properties of tripotassium;2-hexyldecan-1-ol;phosphate?
tripotassium;2-hexyldecan-1-ol;phosphate has a molecular weight of 454.71 g/mol, XLogP of -6.50, 13 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tripotassium;2-hexyldecan-1-ol;phosphate is sourced from PubChem (CID 175022453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).