C10H19O8P — CID 21023155
1-[2-acetyloxypropoxy(hydroxy)phosphoryl]oxypropan-2-yl acetate (PubChem CID 21023155) has the molecular formula C10H19O8P and a molecular weight of 298.23 g/mol. Its IUPAC name is 1-[2-acetyloxypropoxy(hydroxy)phosphoryl]oxypropan-2-yl acetate.
| Compound Name | 1-[2-acetyloxypropoxy(hydroxy)phosphoryl]oxypropan-2-yl acetate |
|---|---|
| PubChem CID | 21023155 |
| Molecular Formula | C10H19O8P |
| Molecular Weight | 298.23 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 1-[2-acetyloxypropoxy(hydroxy)phosphoryl]oxypropan-2-yl acetate |
| SMILES | CC(=O)OC(C)COP(=O)(O)OCC(C)OC(C)=O |
| InChI | InChI=1S/C10H19O8P/c1-7(17-9(3)11)5-15-19(13,14)16-6-8(2)18-10(4)12/h7-8H,5-6H2,1-4H3,(H,13,14) |
| InChIKey | ZSZGGYMJJIFOCN-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|