C8H18NO7P — CID 137319661
[(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] propanoate (PubChem CID 137319661) has the molecular formula C8H18NO7P and a molecular weight of 271.21 g/mol. Its IUPAC name is [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] propanoate.
| Compound Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] propanoate |
|---|---|
| PubChem CID | 137319661 |
| Molecular Formula | C8H18NO7P |
| Molecular Weight | 271.21 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] propanoate |
| SMILES | CCC(=O)OC[C@@H](O)COP(=O)(O)OCCN |
| InChI | InChI=1S/C8H18NO7P/c1-2-8(11)14-5-7(10)6-16-17(12,13)15-4-3-9/h7,10H,2-6,9H2,1H3,(H,12,13)/t7-/m1/s1 |
| InChIKey | ZUFRDQLOLTUREG-SSDOTTSWSA-N |
| XLogP | -0.61 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.21 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|