C10H22NO7P — CID 166174515
[(2S)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] pentanoate (PubChem CID 166174515) has the molecular formula C10H22NO7P and a molecular weight of 299.26 g/mol. Its IUPAC name is [(2S)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] pentanoate.
| Compound Name | [(2S)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] pentanoate |
|---|---|
| PubChem CID | 166174515 |
| Molecular Formula | C10H22NO7P |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | [(2S)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] pentanoate |
| SMILES | CCCCC(=O)OC[C@H](O)COP(=O)(O)OCCN |
| InChI | InChI=1S/C10H22NO7P/c1-2-3-4-10(13)16-7-9(12)8-18-19(14,15)17-6-5-11/h9,12H,2-8,11H2,1H3,(H,14,15)/t9-/m0/s1 |
| InChIKey | CUGLYJHLQCKDMI-VIFPVBQESA-N |
| XLogP | 0.17 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|