C12H24NO8P — CID 165289104
[3-[2-acetamidoethoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] pentanoate (PubChem CID 165289104) has the molecular formula C12H24NO8P and a molecular weight of 341.30 g/mol. Its IUPAC name is [3-[2-acetamidoethoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] pentanoate.
| Compound Name | [3-[2-acetamidoethoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] pentanoate |
|---|---|
| PubChem CID | 165289104 |
| Molecular Formula | C12H24NO8P |
| Molecular Weight | 341.30 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | [3-[2-acetamidoethoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] pentanoate |
| SMILES | CCCCC(=O)OCC(O)COP(=O)(O)OCCNC(C)=O |
| InChI | InChI=1S/C12H24NO8P/c1-3-4-5-12(16)19-8-11(15)9-21-22(17,18)20-7-6-13-10(2)14/h11,15H,3-9H2,1-2H3,(H,13,14)(H,17,18) |
| InChIKey | ROMYZCNJPMKCSG-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.30 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|