C13H26NO8P — CID 165240751
[3-[2-acetamidoethoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] hexanoate (PubChem CID 165240751) has the molecular formula C13H26NO8P and a molecular weight of 355.32 g/mol. Its IUPAC name is [3-[2-acetamidoethoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] hexanoate.
| Compound Name | [3-[2-acetamidoethoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] hexanoate |
|---|---|
| PubChem CID | 165240751 |
| Molecular Formula | C13H26NO8P |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | [3-[2-acetamidoethoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] hexanoate |
| SMILES | CCCCCC(=O)OCC(O)COP(=O)(O)OCCNC(C)=O |
| InChI | InChI=1S/C13H26NO8P/c1-3-4-5-6-13(17)20-9-12(16)10-22-23(18,19)21-8-7-14-11(2)15/h12,16H,3-10H2,1-2H3,(H,14,15)(H,18,19) |
| InChIKey | KEPXSXJQLZFFEG-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|