C25H48NO8P — CID 165331500
[3-[2-acetamidoethoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] (Z)-octadec-9-enoate (PubChem CID 165331500) has the molecular formula C25H48NO8P and a molecular weight of 521.63 g/mol. Its IUPAC name is [3-[2-acetamidoethoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] (Z)-octadec-9-enoate.
| Compound Name | [3-[2-acetamidoethoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 165331500 |
| Molecular Formula | C25H48NO8P |
| Molecular Weight | 521.63 g/mol |
| Exact Mass | 521.31 |
| IUPAC Name | [3-[2-acetamidoethoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(O)COP(=O)(O)OCCNC(C)=O |
| InChI | InChI=1S/C25H48NO8P/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-25(29)32-21-24(28)22-34-35(30,31)33-20-19-26-23(2)27/h10-11,24,28H,3-9,12-22H2,1-2H3,(H,26,27)(H,30,31)/b11-10- |
| InChIKey | YUUGATFNXIZDON-KHPPLWFESA-N |
| XLogP | 5.20 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.63 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|