C29H52NO8P — CID 165290574
[3-[2-acetamidoethoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] (10Z,13Z,16Z)-docosa-10,13,16-trienoate (PubChem CID 165290574) has the molecular formula C29H52NO8P and a molecular weight of 573.71 g/mol. Its IUPAC name is [3-[2-acetamidoethoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] (10Z,13Z,16Z)-docosa-10,13,16-trienoate.
| Compound Name | [3-[2-acetamidoethoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] (10Z,13Z,16Z)-docosa-10,13,16-trienoate |
|---|---|
| PubChem CID | 165290574 |
| Molecular Formula | C29H52NO8P |
| Molecular Weight | 573.71 g/mol |
| Exact Mass | 573.34 |
| IUPAC Name | [3-[2-acetamidoethoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] (10Z,13Z,16Z)-docosa-10,13,16-trienoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCCCCCC(=O)OCC(O)COP(=O)(O)OCCNC(C)=O |
| InChI | InChI=1S/C29H52NO8P/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-29(33)36-25-28(32)26-38-39(34,35)37-24-23-30-27(2)31/h7-8,10-11,13-14,28,32H,3-6,9,12,15-26H2,1-2H3,(H,30,31)(H,34,35)/b8-7-,11-10-,14-13- |
| InChIKey | RUFYZLQSUWPKBI-JPFHKJGASA-N |
| XLogP | 6.31 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.71 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|