C23H42NO8P — CID 165234314
[3-[2-acetamidoethoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] (9Z,12Z)-hexadeca-9,12-dienoate (PubChem CID 165234314) has the molecular formula C23H42NO8P and a molecular weight of 491.56 g/mol. Its IUPAC name is [3-[2-acetamidoethoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] (9Z,12Z)-hexadeca-9,12-dienoate.
| Compound Name | [3-[2-acetamidoethoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] (9Z,12Z)-hexadeca-9,12-dienoate |
|---|---|
| PubChem CID | 165234314 |
| Molecular Formula | C23H42NO8P |
| Molecular Weight | 491.56 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | [3-[2-acetamidoethoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] (9Z,12Z)-hexadeca-9,12-dienoate |
| SMILES | CCC/C=C\C/C=C\CCCCCCCC(=O)OCC(O)COP(=O)(O)OCCNC(C)=O |
| InChI | InChI=1S/C23H42NO8P/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-23(27)30-19-22(26)20-32-33(28,29)31-18-17-24-21(2)25/h5-6,8-9,22,26H,3-4,7,10-20H2,1-2H3,(H,24,25)(H,28,29)/b6-5-,9-8- |
| InChIKey | JFKUTSPXDLTAOJ-AFJQJTPPSA-N |
| XLogP | 4.19 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.56 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|