C41H76NO8P — CID 165278004
[2-hydroxy-3-[hydroxy-[2-[[(Z)-icos-11-enoyl]amino]ethoxy]phosphoryl]oxypropyl] (9Z,12Z)-hexadeca-9,12-dienoate (PubChem CID 165278004) has the molecular formula C41H76NO8P and a molecular weight of 742.03 g/mol. Its IUPAC name is [2-hydroxy-3-[hydroxy-[2-[[(Z)-icos-11-enoyl]amino]ethoxy]phosphoryl]oxypropyl] (9Z,12Z)-hexadeca-9,12-dienoate.
| Compound Name | [2-hydroxy-3-[hydroxy-[2-[[(Z)-icos-11-enoyl]amino]ethoxy]phosphoryl]oxypropyl] (9Z,12Z)-hexadeca-9,12-dienoate |
|---|---|
| PubChem CID | 165278004 |
| Molecular Formula | C41H76NO8P |
| Molecular Weight | 742.03 g/mol |
| Exact Mass | 741.53 |
| IUPAC Name | [2-hydroxy-3-[hydroxy-[2-[[(Z)-icos-11-enoyl]amino]ethoxy]phosphoryl]oxypropyl] (9Z,12Z)-hexadeca-9,12-dienoate |
| SMILES | CCC/C=C\C/C=C\CCCCCCCC(=O)OCC(O)COP(=O)(O)OCCNC(=O)CCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C41H76NO8P/c1-3-5-7-9-11-13-15-17-18-19-20-22-23-25-27-29-31-33-40(44)42-35-36-49-51(46,47)50-38-39(43)37-48-41(45)34-32-30-28-26-24-21-16-14-12-10-8-6-4-2/h8,10,14,16-18,39,43H,3-7,9,11-13,15,19-38H2,1-2H3,(H,42,44)(H,46,47)/b10-8-,16-14-,18-17- |
| InChIKey | PXHAWHDQSYHBNX-XOVNSVORSA-N |
| XLogP | 10.99 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.03 |
| LogP ≤ 5 | 10.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|