C36H64NO8P — CID 165260424
[3-[2-[[(7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] nonanoate (PubChem CID 165260424) has the molecular formula C36H64NO8P and a molecular weight of 669.88 g/mol. Its IUPAC name is [3-[2-[[(7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] nonanoate.
| Compound Name | [3-[2-[[(7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] nonanoate |
|---|---|
| PubChem CID | 165260424 |
| Molecular Formula | C36H64NO8P |
| Molecular Weight | 669.88 g/mol |
| Exact Mass | 669.44 |
| IUPAC Name | [3-[2-[[(7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] nonanoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCCCC(=O)NCCOP(=O)(O)OCC(O)COC(=O)CCCCCCCC |
| InChI | InChI=1S/C36H64NO8P/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-21-22-23-24-26-28-35(39)37-30-31-44-46(41,42)45-33-34(38)32-43-36(40)29-27-25-10-8-6-4-2/h11-12,14-15,17-18,20-21,34,38H,3-10,13,16,19,22-33H2,1-2H3,(H,37,39)(H,41,42)/b12-11-,15-14-,18-17-,21-20- |
| InChIKey | NFAJYBUBJOWRRG-FORXSXPXSA-N |
| XLogP | 8.82 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.88 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|