C44H74NO8P — CID 165332129
[2-hydroxy-3-[hydroxy-[2-[[(Z)-tridec-9-enoyl]amino]ethoxy]phosphoryl]oxypropyl] (8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoate (PubChem CID 165332129) has the molecular formula C44H74NO8P and a molecular weight of 776.05 g/mol. Its IUPAC name is [2-hydroxy-3-[hydroxy-[2-[[(Z)-tridec-9-enoyl]amino]ethoxy]phosphoryl]oxypropyl] (8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoate.
| Compound Name | [2-hydroxy-3-[hydroxy-[2-[[(Z)-tridec-9-enoyl]amino]ethoxy]phosphoryl]oxypropyl] (8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoate |
|---|---|
| PubChem CID | 165332129 |
| Molecular Formula | C44H74NO8P |
| Molecular Weight | 776.05 g/mol |
| Exact Mass | 775.52 |
| IUPAC Name | [2-hydroxy-3-[hydroxy-[2-[[(Z)-tridec-9-enoyl]amino]ethoxy]phosphoryl]oxypropyl] (8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCCC(=O)OCC(O)COP(=O)(O)OCCNC(=O)CCCCCCC/C=C\CCC |
| InChI | InChI=1S/C44H74NO8P/c1-3-5-7-9-11-13-15-16-17-18-19-20-21-22-23-24-25-26-27-29-31-33-35-37-44(48)51-40-42(46)41-53-54(49,50)52-39-38-45-43(47)36-34-32-30-28-14-12-10-8-6-4-2/h5,7-8,10-11,13,16-17,19-20,22-23,25-26,42,46H,3-4,6,9,12,14-15,18,21,24,27-41H2,1-2H3,(H,45,47)(H,49,50)/b7-5-,10-8-,13-11-,17-16-,20-19-,23-22-,26-25- |
| InChIKey | YXNPCNMIRFSKMQ-DJHNAPAOSA-N |
| XLogP | 11.27 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.05 |
| LogP ≤ 5 | 11.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|