C33H58NO8P — CID 165217587
[2-hydroxy-3-[hydroxy-[2-[[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]amino]ethoxy]phosphoryl]oxypropyl] decanoate (PubChem CID 165217587) has the molecular formula C33H58NO8P and a molecular weight of 627.80 g/mol. Its IUPAC name is [2-hydroxy-3-[hydroxy-[2-[[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]amino]ethoxy]phosphoryl]oxypropyl] decanoate.
| Compound Name | [2-hydroxy-3-[hydroxy-[2-[[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]amino]ethoxy]phosphoryl]oxypropyl] decanoate |
|---|---|
| PubChem CID | 165217587 |
| Molecular Formula | C33H58NO8P |
| Molecular Weight | 627.80 g/mol |
| Exact Mass | 627.39 |
| IUPAC Name | [2-hydroxy-3-[hydroxy-[2-[[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]amino]ethoxy]phosphoryl]oxypropyl] decanoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCC(=O)NCCOP(=O)(O)OCC(O)COC(=O)CCCCCCCCC |
| InChI | InChI=1S/C33H58NO8P/c1-3-5-7-9-11-12-13-14-15-16-17-18-20-21-23-25-32(36)34-27-28-41-43(38,39)42-30-31(35)29-40-33(37)26-24-22-19-10-8-6-4-2/h5,7,11-12,14-15,17-18,31,35H,3-4,6,8-10,13,16,19-30H2,1-2H3,(H,34,36)(H,38,39)/b7-5-,12-11-,15-14-,18-17- |
| InChIKey | GRDJXFVZTLISMO-XWVIRPHISA-N |
| XLogP | 7.65 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.80 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|