C34H60NO8P — CID 165232204
[2-hydroxy-3-[hydroxy-[2-[[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]amino]ethoxy]phosphoryl]oxypropyl] undecanoate (PubChem CID 165232204) has the molecular formula C34H60NO8P and a molecular weight of 641.83 g/mol. Its IUPAC name is [2-hydroxy-3-[hydroxy-[2-[[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]amino]ethoxy]phosphoryl]oxypropyl] undecanoate.
| Compound Name | [2-hydroxy-3-[hydroxy-[2-[[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]amino]ethoxy]phosphoryl]oxypropyl] undecanoate |
|---|---|
| PubChem CID | 165232204 |
| Molecular Formula | C34H60NO8P |
| Molecular Weight | 641.83 g/mol |
| Exact Mass | 641.41 |
| IUPAC Name | [2-hydroxy-3-[hydroxy-[2-[[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]amino]ethoxy]phosphoryl]oxypropyl] undecanoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCC(=O)NCCOP(=O)(O)OCC(O)COC(=O)CCCCCCCCCC |
| InChI | InChI=1S/C34H60NO8P/c1-3-5-7-9-11-13-14-15-16-17-18-19-20-22-24-26-33(37)35-28-29-42-44(39,40)43-31-32(36)30-41-34(38)27-25-23-21-12-10-8-6-4-2/h5,7,11,13,15-16,18-19,32,36H,3-4,6,8-10,12,14,17,20-31H2,1-2H3,(H,35,37)(H,39,40)/b7-5-,13-11-,16-15-,19-18- |
| InChIKey | IXBFCHCMLANLPJ-OFAZCYPNSA-N |
| XLogP | 8.04 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.83 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|