C40H68NO8P — CID 165194635
[2-hydroxy-3-[hydroxy-[2-(undecanoylamino)ethoxy]phosphoryl]oxypropyl] (6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-6,9,12,15,18,21-hexaenoate (PubChem CID 165194635) has the molecular formula C40H68NO8P and a molecular weight of 721.96 g/mol. Its IUPAC name is [2-hydroxy-3-[hydroxy-[2-(undecanoylamino)ethoxy]phosphoryl]oxypropyl] (6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-6,9,12,15,18,21-hexaenoate.
| Compound Name | [2-hydroxy-3-[hydroxy-[2-(undecanoylamino)ethoxy]phosphoryl]oxypropyl] (6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-6,9,12,15,18,21-hexaenoate |
|---|---|
| PubChem CID | 165194635 |
| Molecular Formula | C40H68NO8P |
| Molecular Weight | 721.96 g/mol |
| Exact Mass | 721.47 |
| IUPAC Name | [2-hydroxy-3-[hydroxy-[2-(undecanoylamino)ethoxy]phosphoryl]oxypropyl] (6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-6,9,12,15,18,21-hexaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCC(=O)OCC(O)COP(=O)(O)OCCNC(=O)CCCCCCCCCC |
| InChI | InChI=1S/C40H68NO8P/c1-3-5-7-9-11-13-14-15-16-17-18-19-20-21-22-23-24-25-27-29-31-33-40(44)47-36-38(42)37-49-50(45,46)48-35-34-41-39(43)32-30-28-26-12-10-8-6-4-2/h5,7,11,13,15-16,18-19,21-22,24-25,38,42H,3-4,6,8-10,12,14,17,20,23,26-37H2,1-2H3,(H,41,43)(H,45,46)/b7-5-,13-11-,16-15-,19-18-,22-21-,25-24- |
| InChIKey | CDPYPKRQDSPZMU-GALCBNSZSA-N |
| XLogP | 9.93 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.96 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|