C27H48NO8P — CID 165249990
[3-[2-[[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] hexanoate (PubChem CID 165249990) has the molecular formula C27H48NO8P and a molecular weight of 545.65 g/mol. Its IUPAC name is [3-[2-[[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] hexanoate.
| Compound Name | [3-[2-[[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] hexanoate |
|---|---|
| PubChem CID | 165249990 |
| Molecular Formula | C27H48NO8P |
| Molecular Weight | 545.65 g/mol |
| Exact Mass | 545.31 |
| IUPAC Name | [3-[2-[[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] hexanoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCC(=O)NCCOP(=O)(O)OCC(O)COC(=O)CCCCC |
| InChI | InChI=1S/C27H48NO8P/c1-3-5-7-8-9-10-11-12-13-14-15-16-18-19-26(30)28-21-22-35-37(32,33)36-24-25(29)23-34-27(31)20-17-6-4-2/h5,7,9-10,12-13,25,29H,3-4,6,8,11,14-24H2,1-2H3,(H,28,30)(H,32,33)/b7-5-,10-9-,13-12- |
| InChIKey | LPLOLHLKYGEGMS-XQOKXTRKSA-N |
| XLogP | 5.53 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.65 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|