C36H62NO8P — CID 165240306
[2-hydroxy-3-[hydroxy-[2-[[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]amino]ethoxy]phosphoryl]oxypropyl] (Z)-tridec-9-enoate (PubChem CID 165240306) has the molecular formula C36H62NO8P and a molecular weight of 667.87 g/mol. Its IUPAC name is [2-hydroxy-3-[hydroxy-[2-[[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]amino]ethoxy]phosphoryl]oxypropyl] (Z)-tridec-9-enoate.
| Compound Name | [2-hydroxy-3-[hydroxy-[2-[[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]amino]ethoxy]phosphoryl]oxypropyl] (Z)-tridec-9-enoate |
|---|---|
| PubChem CID | 165240306 |
| Molecular Formula | C36H62NO8P |
| Molecular Weight | 667.87 g/mol |
| Exact Mass | 667.42 |
| IUPAC Name | [2-hydroxy-3-[hydroxy-[2-[[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]amino]ethoxy]phosphoryl]oxypropyl] (Z)-tridec-9-enoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCC(=O)NCCOP(=O)(O)OCC(O)COC(=O)CCCCCCC/C=C\CCC |
| InChI | InChI=1S/C36H62NO8P/c1-3-5-7-9-11-13-15-16-17-18-19-20-22-24-26-28-35(39)37-30-31-44-46(41,42)45-33-34(38)32-43-36(40)29-27-25-23-21-14-12-10-8-6-4-2/h5,7-8,10-11,13,16-17,19-20,34,38H,3-4,6,9,12,14-15,18,21-33H2,1-2H3,(H,37,39)(H,41,42)/b7-5-,10-8-,13-11-,17-16-,20-19- |
| InChIKey | KCXDTHPLARIJJD-VEXKFZTGSA-N |
| XLogP | 8.59 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.87 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|