C40H66NO8P — CID 165224529
[3-[2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (Z)-tridec-9-enoate (PubChem CID 165224529) has the molecular formula C40H66NO8P and a molecular weight of 719.94 g/mol. Its IUPAC name is [3-[2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (Z)-tridec-9-enoate.
| Compound Name | [3-[2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (Z)-tridec-9-enoate |
|---|---|
| PubChem CID | 165224529 |
| Molecular Formula | C40H66NO8P |
| Molecular Weight | 719.94 g/mol |
| Exact Mass | 719.45 |
| IUPAC Name | [3-[2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (Z)-tridec-9-enoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NCCOP(=O)(O)OCC(O)COC(=O)CCCCCCC/C=C\CCC |
| InChI | InChI=1S/C40H66NO8P/c1-3-5-7-9-11-13-15-16-17-18-19-20-21-22-23-24-26-28-30-32-39(43)41-34-35-48-50(45,46)49-37-38(42)36-47-40(44)33-31-29-27-25-14-12-10-8-6-4-2/h5,7-8,10-11,13,16-17,19-20,22-23,26,28,38,42H,3-4,6,9,12,14-15,18,21,24-25,27,29-37H2,1-2H3,(H,41,43)(H,45,46)/b7-5-,10-8-,13-11-,17-16-,20-19-,23-22-,28-26- |
| InChIKey | HSMMKVSCAZIIIZ-IJQCMBTKSA-N |
| XLogP | 9.71 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.94 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|