C47H80NO8P — CID 165206017
[3-[2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (Z)-icos-11-enoate (PubChem CID 165206017) has the molecular formula C47H80NO8P and a molecular weight of 818.13 g/mol. Its IUPAC name is [3-[2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (Z)-icos-11-enoate.
| Compound Name | [3-[2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (Z)-icos-11-enoate |
|---|---|
| PubChem CID | 165206017 |
| Molecular Formula | C47H80NO8P |
| Molecular Weight | 818.13 g/mol |
| Exact Mass | 817.56 |
| IUPAC Name | [3-[2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (Z)-icos-11-enoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NCCOP(=O)(O)OCC(O)COC(=O)CCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C47H80NO8P/c1-3-5-7-9-11-13-15-17-19-21-22-24-25-27-29-31-33-35-37-39-46(50)48-41-42-55-57(52,53)56-44-45(49)43-54-47(51)40-38-36-34-32-30-28-26-23-20-18-16-14-12-10-8-6-4-2/h5,7,11,13,17-20,22,24,27,29,33,35,45,49H,3-4,6,8-10,12,14-16,21,23,25-26,28,30-32,34,36-44H2,1-2H3,(H,48,50)(H,52,53)/b7-5-,13-11-,19-17-,20-18-,24-22-,29-27-,35-33- |
| InChIKey | DWSHPWSCKWSVLD-IDUQFFEYSA-N |
| XLogP | 12.44 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.13 |
| LogP ≤ 5 | 12.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|