C44H80NO8P — CID 165259991
[2-hydroxy-3-[hydroxy-[2-[[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]amino]ethoxy]phosphoryl]oxypropyl] (Z)-nonadec-9-enoate (PubChem CID 165259991) has the molecular formula C44H80NO8P and a molecular weight of 782.10 g/mol. Its IUPAC name is [2-hydroxy-3-[hydroxy-[2-[[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]amino]ethoxy]phosphoryl]oxypropyl] (Z)-nonadec-9-enoate.
| Compound Name | [2-hydroxy-3-[hydroxy-[2-[[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]amino]ethoxy]phosphoryl]oxypropyl] (Z)-nonadec-9-enoate |
|---|---|
| PubChem CID | 165259991 |
| Molecular Formula | C44H80NO8P |
| Molecular Weight | 782.10 g/mol |
| Exact Mass | 781.56 |
| IUPAC Name | [2-hydroxy-3-[hydroxy-[2-[[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]amino]ethoxy]phosphoryl]oxypropyl] (Z)-nonadec-9-enoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCCCC(=O)NCCOP(=O)(O)OCC(O)COC(=O)CCCCCCC/C=C\CCCCCCCCC |
| InChI | InChI=1S/C44H80NO8P/c1-3-5-7-9-11-13-15-17-19-21-22-24-26-28-30-32-34-36-43(47)45-38-39-52-54(49,50)53-41-42(46)40-51-44(48)37-35-33-31-29-27-25-23-20-18-16-14-12-10-8-6-4-2/h5,7,11,13,17,19-20,23,42,46H,3-4,6,8-10,12,14-16,18,21-22,24-41H2,1-2H3,(H,45,47)(H,49,50)/b7-5-,13-11-,19-17-,23-20- |
| InChIKey | NDJUQJKTFATGSU-ZNYGDDNASA-N |
| XLogP | 11.94 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.10 |
| LogP ≤ 5 | 11.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|