C10H20NO8P — CID 89188015
[2-(1-hydroxyethoxy)-3-[hydroxy-[(E)-2-(methylamino)ethenoxy]phosphoryl]oxypropyl] acetate (PubChem CID 89188015) has the molecular formula C10H20NO8P and a molecular weight of 313.24 g/mol. Its IUPAC name is [2-(1-hydroxyethoxy)-3-[hydroxy-[(E)-2-(methylamino)ethenoxy]phosphoryl]oxypropyl] acetate.
| Compound Name | [2-(1-hydroxyethoxy)-3-[hydroxy-[(E)-2-(methylamino)ethenoxy]phosphoryl]oxypropyl] acetate |
|---|---|
| PubChem CID | 89188015 |
| Molecular Formula | C10H20NO8P |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | [2-(1-hydroxyethoxy)-3-[hydroxy-[(E)-2-(methylamino)ethenoxy]phosphoryl]oxypropyl] acetate |
| SMILES | CN/C=C/OP(=O)(O)OCC(COC(C)=O)OC(C)O |
| InChI | InChI=1S/C10H20NO8P/c1-8(12)16-6-10(19-9(2)13)7-18-20(14,15)17-5-4-11-3/h4-5,9-11,13H,6-7H2,1-3H3,(H,14,15)/b5-4+ |
| InChIKey | PCSVLWWSVOLDKW-SNAWJCMRSA-N |
| XLogP | 0.10 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|