[(2R)-2,3-diacetyloxypropyl] hydrogen phosphate

C7H12O8P- — CID 59891983

IUPAC[(2R)-2,3-diacetyloxypropyl] hydrogen phosphate
SMILESCC(=O)OC[C@H](COP(=O)([O-])O)OC(C)=O
InChIInChI=1S/C7H13O8P/c1-5(8)13-3-7(15-6(2)9)4-14-16(10,11)12/h7H,3-4H2,1-2H3,(H2,10,11,12)/p-1/t7-/m1/s1
InChIKeyGYIRJTRGVDOQDH-SSDOTTSWSA-M
MW255.14 g/mol
LogP-1.04
Rot. Bonds6

About [(2R)-2,3-diacetyloxypropyl] hydrogen phosphate

[(2R)-2,3-diacetyloxypropyl] hydrogen phosphate (PubChem CID 59891983) has the molecular formula C7H12O8P- and a molecular weight of 255.14 g/mol. Its IUPAC name is [(2R)-2,3-diacetyloxypropyl] hydrogen phosphate.

Molecular Properties

Compound Name[(2R)-2,3-diacetyloxypropyl] hydrogen phosphate
PubChem CID59891983
Molecular FormulaC7H12O8P-
Molecular Weight255.14 g/mol
Exact Mass255.03
IUPAC Name[(2R)-2,3-diacetyloxypropyl] hydrogen phosphate
SMILESCC(=O)OC[C@H](COP(=O)([O-])O)OC(C)=O
InChIInChI=1S/C7H13O8P/c1-5(8)13-3-7(15-6(2)9)4-14-16(10,11)12/h7H,3-4H2,1-2H3,(H2,10,11,12)/p-1/t7-/m1/s1
InChIKeyGYIRJTRGVDOQDH-SSDOTTSWSA-M
XLogP-1.04
TPSA122.19 Ų
H-Bond Donors1
H-Bond Acceptors7
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.14
LogP ≤ 5-1.04
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze [(2R)-2,3-diacetyloxypropyl] hydrogen phosphate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(2R)-2,3-diacetyloxypropyl] hydrogen phosphate?
The IUPAC name of [(2R)-2,3-diacetyloxypropyl] hydrogen phosphate (CID 59891983) is [(2R)-2,3-diacetyloxypropyl] hydrogen phosphate.
What is the SMILES notation for [(2R)-2,3-diacetyloxypropyl] hydrogen phosphate?
The canonical SMILES for [(2R)-2,3-diacetyloxypropyl] hydrogen phosphate is CC(=O)OC[C@H](COP(=O)([O-])O)OC(C)=O.
What is the InChIKey of [(2R)-2,3-diacetyloxypropyl] hydrogen phosphate?
The InChIKey is GYIRJTRGVDOQDH-SSDOTTSWSA-M. The full InChI is InChI=1S/C7H13O8P/c1-5(8)13-3-7(15-6(2)9)4-14-16(10,11)12/h7H,3-4H2,1-2H3,(H2,10,11,12)/p-1/t7-/m1/s1.
What are the key properties of [(2R)-2,3-diacetyloxypropyl] hydrogen phosphate?
[(2R)-2,3-diacetyloxypropyl] hydrogen phosphate has a molecular weight of 255.14 g/mol, XLogP of -1.04, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2,3-diacetyloxypropyl] hydrogen phosphate is sourced from PubChem (CID 59891983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).