C12H25NO7P+ — CID 74654593
2-[2,3-diacetyloxypropoxy(hydroxy)phosphoryl]ethyl-trimethylazanium (PubChem CID 74654593) has the molecular formula C12H25NO7P+ and a molecular weight of 326.31 g/mol. Its IUPAC name is 2-[2,3-diacetyloxypropoxy(hydroxy)phosphoryl]ethyl-trimethylazanium.
| Compound Name | 2-[2,3-diacetyloxypropoxy(hydroxy)phosphoryl]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 74654593 |
| Molecular Formula | C12H25NO7P+ |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 2-[2,3-diacetyloxypropoxy(hydroxy)phosphoryl]ethyl-trimethylazanium |
| SMILES | CC(=O)OCC(COP(=O)(O)CC[N+](C)(C)C)OC(C)=O |
| InChI | InChI=1S/C12H24NO7P/c1-10(14)18-8-12(20-11(2)15)9-19-21(16,17)7-6-13(3,4)5/h12H,6-9H2,1-5H3/p+1 |
| InChIKey | SADLPDQPNWOMMM-UHFFFAOYSA-O |
| XLogP | 0.39 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|