C14H25O13P — CID 138117103
[1-acetyloxy-3-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxypropan-2-yl] propanoate (PubChem CID 138117103) has the molecular formula C14H25O13P and a molecular weight of 432.32 g/mol. Its IUPAC name is [1-acetyloxy-3-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxypropan-2-yl] propanoate.
| Compound Name | [1-acetyloxy-3-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxypropan-2-yl] propanoate |
|---|---|
| PubChem CID | 138117103 |
| Molecular Formula | C14H25O13P |
| Molecular Weight | 432.32 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | [1-acetyloxy-3-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxypropan-2-yl] propanoate |
| SMILES | CCC(=O)OC(COC(C)=O)COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O |
| InChI | InChI=1S/C14H25O13P/c1-3-8(16)26-7(4-24-6(2)15)5-25-28(22,23)27-14-12(20)10(18)9(17)11(19)13(14)21/h7,9-14,17-21H,3-5H2,1-2H3,(H,22,23) |
| InChIKey | ADXAPIGGJVYFJU-UHFFFAOYSA-N |
| XLogP | -2.81 |
| TPSA | 209.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.32 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|