C29H51O13P — CID 138195223
[1-acetyloxy-3-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxypropan-2-yl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 138195223) has the molecular formula C29H51O13P and a molecular weight of 638.69 g/mol. Its IUPAC name is [1-acetyloxy-3-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxypropan-2-yl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [1-acetyloxy-3-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxypropan-2-yl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 138195223 |
| Molecular Formula | C29H51O13P |
| Molecular Weight | 638.69 g/mol |
| Exact Mass | 638.31 |
| IUPAC Name | [1-acetyloxy-3-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxypropan-2-yl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC(COC(C)=O)COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O |
| InChI | InChI=1S/C29H51O13P/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23(31)41-22(19-39-21(2)30)20-40-43(37,38)42-29-27(35)25(33)24(32)26(34)28(29)36/h7-8,10-11,22,24-29,32-36H,3-6,9,12-20H2,1-2H3,(H,37,38)/b8-7-,11-10- |
| InChIKey | KMNWJQXUUKCSAT-NQLNTKRDSA-N |
| XLogP | 2.60 |
| TPSA | 209.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.69 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|