C25H42NO8P — CID 165202207
[2-hydroxy-3-[hydroxy-[2-[[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]amino]ethoxy]phosphoryl]oxypropyl] acetate (PubChem CID 165202207) has the molecular formula C25H42NO8P and a molecular weight of 515.58 g/mol. Its IUPAC name is [2-hydroxy-3-[hydroxy-[2-[[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]amino]ethoxy]phosphoryl]oxypropyl] acetate.
| Compound Name | [2-hydroxy-3-[hydroxy-[2-[[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]amino]ethoxy]phosphoryl]oxypropyl] acetate |
|---|---|
| PubChem CID | 165202207 |
| Molecular Formula | C25H42NO8P |
| Molecular Weight | 515.58 g/mol |
| Exact Mass | 515.26 |
| IUPAC Name | [2-hydroxy-3-[hydroxy-[2-[[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]amino]ethoxy]phosphoryl]oxypropyl] acetate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCC(=O)NCCOP(=O)(O)OCC(O)COC(C)=O |
| InChI | InChI=1S/C25H42NO8P/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-25(29)26-19-20-33-35(30,31)34-22-24(28)21-32-23(2)27/h4-5,7-8,10-11,13-14,24,28H,3,6,9,12,15-22H2,1-2H3,(H,26,29)(H,30,31)/b5-4-,8-7-,11-10-,14-13- |
| InChIKey | DHKHPXRKUWCXBK-GJDCDIHCSA-N |
| XLogP | 4.53 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.58 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|