C45H78NO8P — CID 165336478
[3-[2-[[(11Z,14Z,17Z,20Z,23Z)-hexacosa-11,14,17,20,23-pentaenoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (Z)-tetradec-9-enoate (PubChem CID 165336478) has the molecular formula C45H78NO8P and a molecular weight of 792.09 g/mol. Its IUPAC name is [3-[2-[[(11Z,14Z,17Z,20Z,23Z)-hexacosa-11,14,17,20,23-pentaenoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (Z)-tetradec-9-enoate.
| Compound Name | [3-[2-[[(11Z,14Z,17Z,20Z,23Z)-hexacosa-11,14,17,20,23-pentaenoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (Z)-tetradec-9-enoate |
|---|---|
| PubChem CID | 165336478 |
| Molecular Formula | C45H78NO8P |
| Molecular Weight | 792.09 g/mol |
| Exact Mass | 791.55 |
| IUPAC Name | [3-[2-[[(11Z,14Z,17Z,20Z,23Z)-hexacosa-11,14,17,20,23-pentaenoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (Z)-tetradec-9-enoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCCCCCC(=O)NCCOP(=O)(O)OCC(O)COC(=O)CCCCCCC/C=C\CCCC |
| InChI | InChI=1S/C45H78NO8P/c1-3-5-7-9-11-13-15-16-17-18-19-20-21-22-23-24-25-26-28-29-31-33-35-37-44(48)46-39-40-53-55(50,51)54-42-43(47)41-52-45(49)38-36-34-32-30-27-14-12-10-8-6-4-2/h5,7,10-13,16-17,19-20,22-23,43,47H,3-4,6,8-9,14-15,18,21,24-42H2,1-2H3,(H,46,48)(H,50,51)/b7-5-,12-10-,13-11-,17-16-,20-19-,23-22- |
| InChIKey | ZOUACZZMCMANEX-KYDCZPSUSA-N |
| XLogP | 11.88 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.09 |
| LogP ≤ 5 | 11.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|