C35H62NO8P — CID 165193622
[2-hydroxy-3-[hydroxy-[2-[[(Z)-tetradec-9-enoyl]amino]ethoxy]phosphoryl]oxypropyl] (7Z,10Z,13Z)-hexadeca-7,10,13-trienoate (PubChem CID 165193622) has the molecular formula C35H62NO8P and a molecular weight of 655.85 g/mol. Its IUPAC name is [2-hydroxy-3-[hydroxy-[2-[[(Z)-tetradec-9-enoyl]amino]ethoxy]phosphoryl]oxypropyl] (7Z,10Z,13Z)-hexadeca-7,10,13-trienoate.
| Compound Name | [2-hydroxy-3-[hydroxy-[2-[[(Z)-tetradec-9-enoyl]amino]ethoxy]phosphoryl]oxypropyl] (7Z,10Z,13Z)-hexadeca-7,10,13-trienoate |
|---|---|
| PubChem CID | 165193622 |
| Molecular Formula | C35H62NO8P |
| Molecular Weight | 655.85 g/mol |
| Exact Mass | 655.42 |
| IUPAC Name | [2-hydroxy-3-[hydroxy-[2-[[(Z)-tetradec-9-enoyl]amino]ethoxy]phosphoryl]oxypropyl] (7Z,10Z,13Z)-hexadeca-7,10,13-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCC(=O)OCC(O)COP(=O)(O)OCCNC(=O)CCCCCCC/C=C\CCCC |
| InChI | InChI=1S/C35H62NO8P/c1-3-5-7-9-11-13-15-16-18-20-22-24-26-28-35(39)42-31-33(37)32-44-45(40,41)43-30-29-36-34(38)27-25-23-21-19-17-14-12-10-8-6-4-2/h5,7,10-13,16,18,33,37H,3-4,6,8-9,14-15,17,19-32H2,1-2H3,(H,36,38)(H,40,41)/b7-5-,12-10-,13-11-,18-16- |
| InChIKey | BZQBBEJAEAQDGJ-WBGHLPHUSA-N |
| XLogP | 8.43 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.85 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|