C31H56NO8P — CID 165317028
[3-[2-(hexanoylamino)ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (11Z,14Z,17Z)-icosa-11,14,17-trienoate (PubChem CID 165317028) has the molecular formula C31H56NO8P and a molecular weight of 601.76 g/mol. Its IUPAC name is [3-[2-(hexanoylamino)ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (11Z,14Z,17Z)-icosa-11,14,17-trienoate.
| Compound Name | [3-[2-(hexanoylamino)ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (11Z,14Z,17Z)-icosa-11,14,17-trienoate |
|---|---|
| PubChem CID | 165317028 |
| Molecular Formula | C31H56NO8P |
| Molecular Weight | 601.76 g/mol |
| Exact Mass | 601.37 |
| IUPAC Name | [3-[2-(hexanoylamino)ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (11Z,14Z,17Z)-icosa-11,14,17-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCCCC(=O)OCC(O)COP(=O)(O)OCCNC(=O)CCCCC |
| InChI | InChI=1S/C31H56NO8P/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22-24-31(35)38-27-29(33)28-40-41(36,37)39-26-25-32-30(34)23-21-6-4-2/h5,7,9-10,12-13,29,33H,3-4,6,8,11,14-28H2,1-2H3,(H,32,34)(H,36,37)/b7-5-,10-9-,13-12- |
| InChIKey | WPKJQFJHASJENM-XQOKXTRKSA-N |
| XLogP | 7.09 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.76 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|