C11H21O7P — CID 88647523
[3-[butoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] 2-methylprop-2-enoate (PubChem CID 88647523) has the molecular formula C11H21O7P and a molecular weight of 296.26 g/mol. Its IUPAC name is [3-[butoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] 2-methylprop-2-enoate.
| Compound Name | [3-[butoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88647523 |
| Molecular Formula | C11H21O7P |
| Molecular Weight | 296.26 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | [3-[butoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)COP(=O)(O)OCCCC |
| InChI | InChI=1S/C11H21O7P/c1-4-5-6-17-19(14,15)18-8-10(12)7-16-11(13)9(2)3/h10,12H,2,4-8H2,1,3H3,(H,14,15) |
| InChIKey | RMAPICJGIXVDAO-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.26 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|