C10H19N2O6P — CID 141250925
tert-butyl N-[2-[2-cyanoethoxy(hydroxy)phosphoryl]oxyethyl]carbamate (PubChem CID 141250925) has the molecular formula C10H19N2O6P and a molecular weight of 294.24 g/mol. Its IUPAC name is tert-butyl N-[2-[2-cyanoethoxy(hydroxy)phosphoryl]oxyethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-cyanoethoxy(hydroxy)phosphoryl]oxyethyl]carbamate |
|---|---|
| PubChem CID | 141250925 |
| Molecular Formula | C10H19N2O6P |
| Molecular Weight | 294.24 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | tert-butyl N-[2-[2-cyanoethoxy(hydroxy)phosphoryl]oxyethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOP(=O)(O)OCCC#N |
| InChI | InChI=1S/C10H19N2O6P/c1-10(2,3)18-9(13)12-6-8-17-19(14,15)16-7-4-5-11/h4,6-8H2,1-3H3,(H,12,13)(H,14,15) |
| InChIKey | FJUQTKPJTHAKPM-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 117.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.24 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|