C13H23N2O8P — CID 23420398
methyl 3-[2-cyanoethoxy(hydroxy)phosphoryl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 23420398) has the molecular formula C13H23N2O8P and a molecular weight of 366.31 g/mol. Its IUPAC name is methyl 3-[2-cyanoethoxy(hydroxy)phosphoryl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | methyl 3-[2-cyanoethoxy(hydroxy)phosphoryl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 23420398 |
| Molecular Formula | C13H23N2O8P |
| Molecular Weight | 366.31 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | methyl 3-[2-cyanoethoxy(hydroxy)phosphoryl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | COC(=O)C(NC(=O)OC(C)(C)C)C(C)OP(=O)(O)OCCC#N |
| InChI | InChI=1S/C13H23N2O8P/c1-9(23-24(18,19)21-8-6-7-14)10(11(16)20-5)15-12(17)22-13(2,3)4/h9-10H,6,8H2,1-5H3,(H,15,17)(H,18,19) |
| InChIKey | TWFOQWLQOYVGOF-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 144.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|