C7H13N2O4PS — CID 23420320
methyl 2-[[2-cyanoethoxy(hydroxy)phosphinothioyl]amino]propanoate (PubChem CID 23420320) has the molecular formula C7H13N2O4PS and a molecular weight of 252.23 g/mol. Its IUPAC name is methyl 2-[[2-cyanoethoxy(hydroxy)phosphinothioyl]amino]propanoate.
| Compound Name | methyl 2-[[2-cyanoethoxy(hydroxy)phosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 23420320 |
| Molecular Formula | C7H13N2O4PS |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | methyl 2-[[2-cyanoethoxy(hydroxy)phosphinothioyl]amino]propanoate |
| SMILES | COC(=O)C(C)NP(O)(=S)OCCC#N |
| InChI | InChI=1S/C7H13N2O4PS/c1-6(7(10)12-2)9-14(11,15)13-5-3-4-8/h6H,3,5H2,1-2H3,(H2,9,11,15) |
| InChIKey | PIVZPOXGTNZVMD-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 91.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|