C18H34N3O8P — CID 171599723
1,3-bis(5-methoxypentanoylamino)propan-2-yl 2-cyanoethyl hydrogen phosphate (PubChem CID 171599723) has the molecular formula C18H34N3O8P and a molecular weight of 451.46 g/mol. Its IUPAC name is 1,3-bis(5-methoxypentanoylamino)propan-2-yl 2-cyanoethyl hydrogen phosphate.
| Compound Name | 1,3-bis(5-methoxypentanoylamino)propan-2-yl 2-cyanoethyl hydrogen phosphate |
|---|---|
| PubChem CID | 171599723 |
| Molecular Formula | C18H34N3O8P |
| Molecular Weight | 451.46 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 1,3-bis(5-methoxypentanoylamino)propan-2-yl 2-cyanoethyl hydrogen phosphate |
| SMILES | COCCCCC(=O)NCC(CNC(=O)CCCCOC)OP(=O)(O)OCCC#N |
| InChI | InChI=1S/C18H34N3O8P/c1-26-11-5-3-8-17(22)20-14-16(29-30(24,25)28-13-7-10-19)15-21-18(23)9-4-6-12-27-2/h16H,3-9,11-15H2,1-2H3,(H,20,22)(H,21,23)(H,24,25) |
| InChIKey | SGNSFPMWMPKLRM-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 156.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.46 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|