C20H41N2O10PS — CID 118346320
N-[2-[hydroxy-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]phosphinothioyl]oxy-2-(5-methoxypentanoylamino)ethyl]-5-methoxypentanamide (PubChem CID 118346320) has the molecular formula C20H41N2O10PS and a molecular weight of 532.59 g/mol. Its IUPAC name is N-[2-[hydroxy-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]phosphinothioyl]oxy-2-(5-methoxypentanoylamino)ethyl]-5-methoxypentanamide.
| Compound Name | N-[2-[hydroxy-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]phosphinothioyl]oxy-2-(5-methoxypentanoylamino)ethyl]-5-methoxypentanamide |
|---|---|
| PubChem CID | 118346320 |
| Molecular Formula | C20H41N2O10PS |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | N-[2-[hydroxy-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]phosphinothioyl]oxy-2-(5-methoxypentanoylamino)ethyl]-5-methoxypentanamide |
| SMILES | COCCCCC(=O)NCC(NC(=O)CCCCOC)OP(O)(=S)OCCOCCOCCO |
| InChI | InChI=1S/C20H41N2O10PS/c1-27-10-5-3-7-18(24)21-17-20(22-19(25)8-4-6-11-28-2)32-33(26,34)31-16-15-30-14-13-29-12-9-23/h20,23H,3-17H2,1-2H3,(H,21,24)(H,22,25)(H,26,34) |
| InChIKey | ZDFTUVKLTHAYHD-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 154.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|