C12H26N2O4 — CID 103175984
6-[2-(3-methoxypropoxy)ethoxy]hexanehydrazide (PubChem CID 103175984) has the molecular formula C12H26N2O4 and a molecular weight of 262.35 g/mol. Its IUPAC name is 6-[2-(3-methoxypropoxy)ethoxy]hexanehydrazide.
| Compound Name | 6-[2-(3-methoxypropoxy)ethoxy]hexanehydrazide |
|---|---|
| PubChem CID | 103175984 |
| Molecular Formula | C12H26N2O4 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 6-[2-(3-methoxypropoxy)ethoxy]hexanehydrazide |
| SMILES | COCCCOCCOCCCCCC(=O)NN |
| InChI | InChI=1S/C12H26N2O4/c1-16-7-5-9-18-11-10-17-8-4-2-3-6-12(15)14-13/h2-11,13H2,1H3,(H,14,15) |
| InChIKey | OLAJPKIRHLTJRC-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|