C19H39N2O10PS — CID 126626249
5-hydroxy-N-[2-[hydroxy-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]phosphinothioyl]oxy-3-(5-hydroxypentanoylamino)propyl]pentanamide (PubChem CID 126626249) has the molecular formula C19H39N2O10PS and a molecular weight of 518.57 g/mol. Its IUPAC name is 5-hydroxy-N-[2-[hydroxy-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]phosphinothioyl]oxy-3-(5-hydroxypentanoylamino)propyl]pentanamide.
| Compound Name | 5-hydroxy-N-[2-[hydroxy-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]phosphinothioyl]oxy-3-(5-hydroxypentanoylamino)propyl]pentanamide |
|---|---|
| PubChem CID | 126626249 |
| Molecular Formula | C19H39N2O10PS |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | 5-hydroxy-N-[2-[hydroxy-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]phosphinothioyl]oxy-3-(5-hydroxypentanoylamino)propyl]pentanamide |
| SMILES | O=C(CCCCO)NCC(CNC(=O)CCCCO)OP(O)(=S)OCCOCCOCCO |
| InChI | InChI=1S/C19H39N2O10PS/c22-7-3-1-5-18(25)20-15-17(16-21-19(26)6-2-4-8-23)31-32(27,33)30-14-13-29-12-11-28-10-9-24/h17,22-24H,1-16H2,(H,20,25)(H,21,26)(H,27,33) |
| InChIKey | ICCXSIPTQHONLA-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 176.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|