C4H8Cl2NO2PS — CID 10868283
methyl (2R)-2-(dichlorophosphinothioylamino)propanoate (PubChem CID 10868283) has the molecular formula C4H8Cl2NO2PS and a molecular weight of 236.06 g/mol. Its IUPAC name is methyl (2R)-2-(dichlorophosphinothioylamino)propanoate.
| Compound Name | methyl (2R)-2-(dichlorophosphinothioylamino)propanoate |
|---|---|
| PubChem CID | 10868283 |
| Molecular Formula | C4H8Cl2NO2PS |
| Molecular Weight | 236.06 g/mol |
| Exact Mass | 234.94 |
| IUPAC Name | methyl (2R)-2-(dichlorophosphinothioylamino)propanoate |
| SMILES | COC(=O)[C@@H](C)NP(=S)(Cl)Cl |
| InChI | InChI=1S/C4H8Cl2NO2PS/c1-3(4(8)9-2)7-10(5,6)11/h3H,1-2H3,(H,7,11)/t3-/m1/s1 |
| InChIKey | UXKVOPULAHMBCG-GSVOUGTGSA-N |
| XLogP | 1.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.06 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|