C10H16N3O4PS — CID 165352885
methyl (2S)-2-[bis(2-cyanoethoxy)phosphinothioylamino]propanoate (PubChem CID 165352885) has the molecular formula C10H16N3O4PS and a molecular weight of 305.30 g/mol. Its IUPAC name is methyl (2S)-2-[bis(2-cyanoethoxy)phosphinothioylamino]propanoate.
| Compound Name | methyl (2S)-2-[bis(2-cyanoethoxy)phosphinothioylamino]propanoate |
|---|---|
| PubChem CID | 165352885 |
| Molecular Formula | C10H16N3O4PS |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | methyl (2S)-2-[bis(2-cyanoethoxy)phosphinothioylamino]propanoate |
| SMILES | COC(=O)[C@H](C)NP(=S)(OCCC#N)OCCC#N |
| InChI | InChI=1S/C10H16N3O4PS/c1-9(10(14)15-2)13-18(19,16-7-3-5-11)17-8-4-6-12/h9H,3-4,7-8H2,1-2H3,(H,13,19)/t9-/m0/s1 |
| InChIKey | PMDVUKYQTBJDKQ-VIFPVBQESA-N |
| XLogP | 1.22 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|