dimethyl 2-(4-cyanobutan-2-yl)butanedioate

C11H17NO4 — CID 122220914

IUPACdimethyl 2-(4-cyanobutan-2-yl)butanedioate
SMILESCOC(=O)CC(C(=O)OC)C(C)CCC#N
InChIInChI=1S/C11H17NO4/c1-8(5-4-6-12)9(11(14)16-3)7-10(13)15-2/h8-9H,4-5,7H2,1-3H3
InChIKeyRDYUBFMRZKMTSJ-UHFFFAOYSA-N
MW227.26 g/mol
LogP1.28
Rot. Bonds6

About dimethyl 2-(4-cyanobutan-2-yl)butanedioate

dimethyl 2-(4-cyanobutan-2-yl)butanedioate (PubChem CID 122220914) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is dimethyl 2-(4-cyanobutan-2-yl)butanedioate.

Molecular Properties

Compound Namedimethyl 2-(4-cyanobutan-2-yl)butanedioate
PubChem CID122220914
Molecular FormulaC11H17NO4
Molecular Weight227.26 g/mol
Exact Mass227.12
IUPAC Namedimethyl 2-(4-cyanobutan-2-yl)butanedioate
SMILESCOC(=O)CC(C(=O)OC)C(C)CCC#N
InChIInChI=1S/C11H17NO4/c1-8(5-4-6-12)9(11(14)16-3)7-10(13)15-2/h8-9H,4-5,7H2,1-3H3
InChIKeyRDYUBFMRZKMTSJ-UHFFFAOYSA-N
XLogP1.28
TPSA76.39 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.26
LogP ≤ 51.28
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze dimethyl 2-(4-cyanobutan-2-yl)butanedioate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of dimethyl 2-(4-cyanobutan-2-yl)butanedioate?
The IUPAC name of dimethyl 2-(4-cyanobutan-2-yl)butanedioate (CID 122220914) is dimethyl 2-(4-cyanobutan-2-yl)butanedioate.
What is the SMILES notation for dimethyl 2-(4-cyanobutan-2-yl)butanedioate?
The canonical SMILES for dimethyl 2-(4-cyanobutan-2-yl)butanedioate is COC(=O)CC(C(=O)OC)C(C)CCC#N.
What is the InChIKey of dimethyl 2-(4-cyanobutan-2-yl)butanedioate?
The InChIKey is RDYUBFMRZKMTSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO4/c1-8(5-4-6-12)9(11(14)16-3)7-10(13)15-2/h8-9H,4-5,7H2,1-3H3.
What are the key properties of dimethyl 2-(4-cyanobutan-2-yl)butanedioate?
dimethyl 2-(4-cyanobutan-2-yl)butanedioate has a molecular weight of 227.26 g/mol, XLogP of 1.28, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-(4-cyanobutan-2-yl)butanedioate is sourced from PubChem (CID 122220914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).