C8H15N3O — CID 174428654
2-amino-5-cyano-N,3-dimethylpentanamide (PubChem CID 174428654) has the molecular formula C8H15N3O and a molecular weight of 169.23 g/mol. Its IUPAC name is 2-amino-5-cyano-N,3-dimethylpentanamide.
| Compound Name | 2-amino-5-cyano-N,3-dimethylpentanamide |
|---|---|
| PubChem CID | 174428654 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | 2-amino-5-cyano-N,3-dimethylpentanamide |
| SMILES | CNC(=O)C(N)C(C)CCC#N |
| InChI | InChI=1S/C8H15N3O/c1-6(4-3-5-9)7(10)8(12)11-2/h6-7H,3-4,10H2,1-2H3,(H,11,12) |
| InChIKey | YNPUZZJIZRXIIL-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |