C7H18N2O2 — CID 155713767
2-amino-3-hydroxy-N-methylbutanamide;ethane (PubChem CID 155713767) has the molecular formula C7H18N2O2 and a molecular weight of 162.23 g/mol. Its IUPAC name is 2-amino-3-hydroxy-N-methylbutanamide;ethane.
| Compound Name | 2-amino-3-hydroxy-N-methylbutanamide;ethane |
|---|---|
| PubChem CID | 155713767 |
| Molecular Formula | C7H18N2O2 |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | 2-amino-3-hydroxy-N-methylbutanamide;ethane |
| SMILES | CC.CNC(=O)C(N)C(C)O |
| InChI | InChI=1S/C5H12N2O2.C2H6/c1-3(8)4(6)5(9)7-2;1-2/h3-4,8H,6H2,1-2H3,(H,7,9);1-2H3 |
| InChIKey | BSUUXUOUIXRTED-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |