acetic acid;2-amino-N-methylpropanamide

C6H14N2O3 — CID 71335706

IUPACacetic acid;2-amino-N-methylpropanamide
SMILESCC(=O)O.CNC(=O)C(C)N
InChIInChI=1S/C4H10N2O.C2H4O2/c1-3(5)4(7)6-2;1-2(3)4/h3H,5H2,1-2H3,(H,6,7);1H3,(H,3,4)
InChIKeyWJOSMPMEKKEWGT-UHFFFAOYSA-N
MW162.19 g/mol
LogP-0.83
Rot. Bonds1

About acetic acid;2-amino-N-methylpropanamide

acetic acid;2-amino-N-methylpropanamide (PubChem CID 71335706) has the molecular formula C6H14N2O3 and a molecular weight of 162.19 g/mol. Its IUPAC name is acetic acid;2-amino-N-methylpropanamide.

Molecular Properties

Compound Nameacetic acid;2-amino-N-methylpropanamide
PubChem CID71335706
Molecular FormulaC6H14N2O3
Molecular Weight162.19 g/mol
Exact Mass162.10
IUPAC Nameacetic acid;2-amino-N-methylpropanamide
SMILESCC(=O)O.CNC(=O)C(C)N
InChIInChI=1S/C4H10N2O.C2H4O2/c1-3(5)4(7)6-2;1-2(3)4/h3H,5H2,1-2H3,(H,6,7);1H3,(H,3,4)
InChIKeyWJOSMPMEKKEWGT-UHFFFAOYSA-N
XLogP-0.83
TPSA92.42 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500162.19
LogP ≤ 5-0.83
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze acetic acid;2-amino-N-methylpropanamide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;2-amino-N-methylpropanamide?
The IUPAC name of acetic acid;2-amino-N-methylpropanamide (CID 71335706) is acetic acid;2-amino-N-methylpropanamide.
What is the SMILES notation for acetic acid;2-amino-N-methylpropanamide?
The canonical SMILES for acetic acid;2-amino-N-methylpropanamide is CC(=O)O.CNC(=O)C(C)N.
What is the InChIKey of acetic acid;2-amino-N-methylpropanamide?
The InChIKey is WJOSMPMEKKEWGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2O.C2H4O2/c1-3(5)4(7)6-2;1-2(3)4/h3H,5H2,1-2H3,(H,6,7);1H3,(H,3,4).
What are the key properties of acetic acid;2-amino-N-methylpropanamide?
acetic acid;2-amino-N-methylpropanamide has a molecular weight of 162.19 g/mol, XLogP of -0.83, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2-amino-N-methylpropanamide is sourced from PubChem (CID 71335706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).