C6H12N2O4 — CID 5168238
2,3-dihydroxy-N,N'-dimethylbutanediamide (PubChem CID 5168238) has the molecular formula C6H12N2O4 and a molecular weight of 176.17 g/mol. Its IUPAC name is 2,3-dihydroxy-N,N'-dimethylbutanediamide.
| Compound Name | 2,3-dihydroxy-N,N'-dimethylbutanediamide |
|---|---|
| PubChem CID | 5168238 |
| Molecular Formula | C6H12N2O4 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 2,3-dihydroxy-N,N'-dimethylbutanediamide |
| SMILES | CNC(=O)C(O)C(O)C(=O)NC |
| InChI | InChI=1S/C6H12N2O4/c1-7-5(11)3(9)4(10)6(12)8-2/h3-4,9-10H,1-2H3,(H,7,11)(H,8,12) |
| InChIKey | CHDFSSOBPYXWDD-UHFFFAOYSA-N |
| XLogP | -2.80 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |