C17H18N2O4 — CID 143478445
2,3-dihydroxy-N-methyl-N'-(4-phenylphenyl)butanediamide (PubChem CID 143478445) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is 2,3-dihydroxy-N-methyl-N'-(4-phenylphenyl)butanediamide.
| Compound Name | 2,3-dihydroxy-N-methyl-N'-(4-phenylphenyl)butanediamide |
|---|---|
| PubChem CID | 143478445 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 2,3-dihydroxy-N-methyl-N'-(4-phenylphenyl)butanediamide |
| SMILES | CNC(=O)C(O)C(O)C(=O)Nc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C17H18N2O4/c1-18-16(22)14(20)15(21)17(23)19-13-9-7-12(8-10-13)11-5-3-2-4-6-11/h2-10,14-15,20-21H,1H3,(H,18,22)(H,19,23) |
| InChIKey | DGLRIMNFCOQDON-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |