C15H22N2O4 — CID 23585233
N-(4-butan-2-ylphenyl)-2,3-dihydroxy-N'-methylbutanediamide (PubChem CID 23585233) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is N-(4-butan-2-ylphenyl)-2,3-dihydroxy-N'-methylbutanediamide.
| Compound Name | N-(4-butan-2-ylphenyl)-2,3-dihydroxy-N'-methylbutanediamide |
|---|---|
| PubChem CID | 23585233 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | N-(4-butan-2-ylphenyl)-2,3-dihydroxy-N'-methylbutanediamide |
| SMILES | CCC(C)c1ccc(NC(=O)C(O)C(O)C(=O)NC)cc1 |
| InChI | InChI=1S/C15H22N2O4/c1-4-9(2)10-5-7-11(8-6-10)17-15(21)13(19)12(18)14(20)16-3/h5-9,12-13,18-19H,4H2,1-3H3,(H,16,20)(H,17,21) |
| InChIKey | PWZMIFSIGCTBOR-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |