C7H14N2O5 — CID 102499782
(2R,4R)-2,3,4-trihydroxy-N,N'-dimethylpentanediamide (PubChem CID 102499782) has the molecular formula C7H14N2O5 and a molecular weight of 206.20 g/mol. Its IUPAC name is (2R,4R)-2,3,4-trihydroxy-N,N'-dimethylpentanediamide.
| Compound Name | (2R,4R)-2,3,4-trihydroxy-N,N'-dimethylpentanediamide |
|---|---|
| PubChem CID | 102499782 |
| Molecular Formula | C7H14N2O5 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (2R,4R)-2,3,4-trihydroxy-N,N'-dimethylpentanediamide |
| SMILES | CNC(=O)[C@H](O)C(O)[C@@H](O)C(=O)NC |
| InChI | InChI=1S/C7H14N2O5/c1-8-6(13)4(11)3(10)5(12)7(14)9-2/h3-5,10-12H,1-2H3,(H,8,13)(H,9,14)/t4-,5-/m1/s1 |
| InChIKey | FIBONPJHLBKLKO-RFZPGFLSSA-N |
| XLogP | -3.44 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | -3.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |